C20H18O5 — CID 139941919
3,4-bis(4-methoxyphenoxy)phenol (PubChem CID 139941919) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenoxy)phenol.
| Compound Name | 3,4-bis(4-methoxyphenoxy)phenol |
|---|---|
| PubChem CID | 139941919 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3,4-bis(4-methoxyphenoxy)phenol |
| SMILES | COc1ccc(Oc2ccc(O)cc2Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H18O5/c1-22-15-4-8-17(9-5-15)24-19-12-3-14(21)13-20(19)25-18-10-6-16(23-2)7-11-18/h3-13,21H,1-2H3 |
| InChIKey | FQBITDLCKOBYAE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |