C41H28O7 — CID 140957067
(4-hydroxyphenyl)-[4-[4-[4-[4-(4-methoxybenzoyl)benzoyl]phenoxy]benzoyl]phenyl]methanone (PubChem CID 140957067) has the molecular formula C41H28O7 and a molecular weight of 632.67 g/mol. Its IUPAC name is (4-hydroxyphenyl)-[4-[4-[4-[4-(4-methoxybenzoyl)benzoyl]phenoxy]benzoyl]phenyl]methanone.
| Compound Name | (4-hydroxyphenyl)-[4-[4-[4-[4-(4-methoxybenzoyl)benzoyl]phenoxy]benzoyl]phenyl]methanone |
|---|---|
| PubChem CID | 140957067 |
| Molecular Formula | C41H28O7 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | (4-hydroxyphenyl)-[4-[4-[4-[4-(4-methoxybenzoyl)benzoyl]phenoxy]benzoyl]phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2ccc(C(=O)c3ccc(Oc4ccc(C(=O)c5ccc(C(=O)c6ccc(O)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H28O7/c1-47-35-20-12-31(13-21-35)39(44)27-6-8-29(9-7-27)41(46)33-16-24-37(25-17-33)48-36-22-14-32(15-23-36)40(45)28-4-2-26(3-5-28)38(43)30-10-18-34(42)19-11-30/h2-25,42H,1H3 |
| InChIKey | FLODHHHUCMWFKY-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |