C40H32F2O6 — CID 158296808
benzene-1,4-diol;bis(4-fluorophenyl)methanone;[4-(4-methoxyphenoxy)phenyl]-(4-methylphenyl)methanone (PubChem CID 158296808) has the molecular formula C40H32F2O6 and a molecular weight of 646.69 g/mol. Its IUPAC name is benzene-1,4-diol;bis(4-fluorophenyl)methanone;[4-(4-methoxyphenoxy)phenyl]-(4-methylphenyl)methanone.
| Compound Name | benzene-1,4-diol;bis(4-fluorophenyl)methanone;[4-(4-methoxyphenoxy)phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 158296808 |
| Molecular Formula | C40H32F2O6 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | benzene-1,4-diol;bis(4-fluorophenyl)methanone;[4-(4-methoxyphenoxy)phenyl]-(4-methylphenyl)methanone |
| SMILES | COc1ccc(Oc2ccc(C(=O)c3ccc(C)cc3)cc2)cc1.O=C(c1ccc(F)cc1)c1ccc(F)cc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C21H18O3.C13H8F2O.C6H6O2/c1-15-3-5-16(6-4-15)21(22)17-7-9-19(10-8-17)24-20-13-11-18(23-2)12-14-20;14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10;7-5-1-2-6(8)4-3-5/h3-14H,1-2H3;1-8H;1-4,7-8H |
| InChIKey | GLZZUUPXMKFEJK-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|