C26H32O3 — CID 144963303
ethane;[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)methanone;2-methylpropane (PubChem CID 144963303) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is ethane;[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)methanone;2-methylpropane.
| Compound Name | ethane;[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)methanone;2-methylpropane |
|---|---|
| PubChem CID | 144963303 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | ethane;[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)methanone;2-methylpropane |
| SMILES | CC.CC(C)C.Cc1ccc(C(=O)c2ccc(Oc3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H16O3.C4H10.C2H6/c1-14-2-4-15(5-3-14)20(22)16-6-10-18(11-7-16)23-19-12-8-17(21)9-13-19;1-4(2)3;1-2/h2-13,21H,1H3;4H,1-3H3;1-2H3 |
| InChIKey | QSGLQTQDDJNGKY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |