C45H46O5 — CID 159686402
bis[4-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]methanone;methane (PubChem CID 159686402) has the molecular formula C45H46O5 and a molecular weight of 666.86 g/mol. Its IUPAC name is bis[4-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]methanone;methane.
| Compound Name | bis[4-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]methanone;methane |
|---|---|
| PubChem CID | 159686402 |
| Molecular Formula | C45H46O5 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | bis[4-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]methanone;methane |
| SMILES | C.C.CC(C)(c1ccc(O)cc1)c1ccc(Oc2ccc(C(=O)c3ccc(Oc4ccc(C(C)(C)c5ccc(O)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H38O5.2CH4/c1-42(2,31-9-17-35(44)18-10-31)33-13-25-39(26-14-33)47-37-21-5-29(6-22-37)41(46)30-7-23-38(24-8-30)48-40-27-15-34(16-28-40)43(3,4)32-11-19-36(45)20-12-32;;/h5-28,44-45H,1-4H3;2*1H4 |
| InChIKey | MVVWWFCTSNGQSQ-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |