C40H38N4O3 — CID 175338942
4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;bis(4-aminophenyl)methanone (PubChem CID 175338942) has the molecular formula C40H38N4O3 and a molecular weight of 622.77 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;bis(4-aminophenyl)methanone.
| Compound Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;bis(4-aminophenyl)methanone |
|---|---|
| PubChem CID | 175338942 |
| Molecular Formula | C40H38N4O3 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;bis(4-aminophenyl)methanone |
| SMILES | CC(C)(c1ccc(Oc2ccc(N)cc2)cc1)c1ccc(Oc2ccc(N)cc2)cc1.Nc1ccc(C(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O2.C13H12N2O/c1-27(2,19-3-11-23(12-4-19)30-25-15-7-21(28)8-16-25)20-5-13-24(14-6-20)31-26-17-9-22(29)10-18-26;14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h3-18H,28-29H2,1-2H3;1-8H,14-15H2 |
| InChIKey | GQWPRSSAUAORJT-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|