C50H54N2O2 — CID 164706220
4-[4-[2-[4-[1-[4-[3-[4-(4-aminophenoxy)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phenyl]ethenyl]phenyl]propan-2-yl]phenoxy]aniline (PubChem CID 164706220) has the molecular formula C50H54N2O2 and a molecular weight of 714.99 g/mol. Its IUPAC name is 4-[4-[2-[4-[1-[4-[3-[4-(4-aminophenoxy)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phenyl]ethenyl]phenyl]propan-2-yl]phenoxy]aniline.
| Compound Name | 4-[4-[2-[4-[1-[4-[3-[4-(4-aminophenoxy)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phenyl]ethenyl]phenyl]propan-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 164706220 |
| Molecular Formula | C50H54N2O2 |
| Molecular Weight | 714.99 g/mol |
| Exact Mass | 714.42 |
| IUPAC Name | 4-[4-[2-[4-[1-[4-[3-[4-(4-aminophenoxy)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phenyl]ethenyl]phenyl]propan-2-yl]phenoxy]aniline |
| SMILES | C=C(c1ccc(C(C)(C)c2ccc(Oc3ccc(N)cc3)cc2)cc1)c1ccc(C(c2ccc(Oc3ccc(N)cc3)cc2)(C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C50H54N2O2/c1-34(35-10-14-37(15-11-35)49(8,9)38-18-26-43(27-19-38)53-45-30-22-41(51)23-31-45)36-12-16-39(17-13-36)50(47(2,3)4,48(5,6)7)40-20-28-44(29-21-40)54-46-32-24-42(52)25-33-46/h10-33H,1,51-52H2,2-9H3 |
| InChIKey | FVGFZVGXLKZLIC-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.99 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|