C16H19NO3 — CID 54340762
3-[4-(4-aminophenoxy)phenyl]butane-1,3-diol (PubChem CID 54340762) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-[4-(4-aminophenoxy)phenyl]butane-1,3-diol.
| Compound Name | 3-[4-(4-aminophenoxy)phenyl]butane-1,3-diol |
|---|---|
| PubChem CID | 54340762 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3-[4-(4-aminophenoxy)phenyl]butane-1,3-diol |
| SMILES | CC(O)(CCO)c1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H19NO3/c1-16(19,10-11-18)12-2-6-14(7-3-12)20-15-8-4-13(17)5-9-15/h2-9,18-19H,10-11,17H2,1H3 |
| InChIKey | TYUAPCBQJHIWDT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|