C16H16Cl2O3 — CID 21322564
3-[4-(2,4-dichlorophenoxy)phenyl]butane-1,3-diol (PubChem CID 21322564) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is 3-[4-(2,4-dichlorophenoxy)phenyl]butane-1,3-diol.
| Compound Name | 3-[4-(2,4-dichlorophenoxy)phenyl]butane-1,3-diol |
|---|---|
| PubChem CID | 21322564 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-[4-(2,4-dichlorophenoxy)phenyl]butane-1,3-diol |
| SMILES | CC(O)(CCO)c1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2O3/c1-16(20,8-9-19)11-2-5-13(6-3-11)21-15-7-4-12(17)10-14(15)18/h2-7,10,19-20H,8-9H2,1H3 |
| InChIKey | RUWLAQQNKCSFID-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |