C14H13Cl3O3 — CID 67724550
5-chloro-2-(2,4-dichlorophenoxy)phenol;ethanol (PubChem CID 67724550) has the molecular formula C14H13Cl3O3 and a molecular weight of 335.61 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenoxy)phenol;ethanol.
| Compound Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol;ethanol |
|---|---|
| PubChem CID | 67724550 |
| Molecular Formula | C14H13Cl3O3 |
| Molecular Weight | 335.61 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol;ethanol |
| SMILES | CCO.Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O2.C2H6O/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16;1-2-3/h1-6,16H;3H,2H2,1H3 |
| InChIKey | DDAMEQUPNHQFRL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |