C18H23Cl4N5O2 — CID 176541548
2-butyl-1-carbamimidoylguanidine;5-chloro-2-(2,4-dichlorophenoxy)phenol;hydrochloride (PubChem CID 176541548) has the molecular formula C18H23Cl4N5O2 and a molecular weight of 483.23 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;5-chloro-2-(2,4-dichlorophenoxy)phenol;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;5-chloro-2-(2,4-dichlorophenoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 176541548 |
| Molecular Formula | C18H23Cl4N5O2 |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;5-chloro-2-(2,4-dichlorophenoxy)phenol;hydrochloride |
| SMILES | Cl.Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C12H7Cl3O2.C6H15N5.ClH/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16;1-2-3-4-10-6(9)11-5(7)8;/h1-6,16H;2-4H2,1H3,(H6,7,8,9,10,11);1H |
| InChIKey | VOWCDGNNTXMPMY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 129.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|