C6H18ClCrN5O4 — CID 176527980
2-butyl-1-carbamimidoylguanidine;dihydroxy(dioxo)chromium;hydrochloride (PubChem CID 176527980) has the molecular formula C6H18ClCrN5O4 and a molecular weight of 311.69 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;dihydroxy(dioxo)chromium;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;dihydroxy(dioxo)chromium;hydrochloride |
|---|---|
| PubChem CID | 176527980 |
| Molecular Formula | C6H18ClCrN5O4 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;dihydroxy(dioxo)chromium;hydrochloride |
| SMILES | Cl.O=[Cr](=O)(O)O.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.ClH.Cr.2H2O.2O/c1-2-3-4-10-6(9)11-5(7)8;;;;;;/h2-4H2,1H3,(H6,7,8,9,10,11);1H;;2*1H2;;/q;;+2;;;;/p-2 |
| InChIKey | JGRYUJCSHCQBNC-UHFFFAOYSA-L |
| XLogP | -1.35 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|