C6H17Cl2N5O4 — CID 176522224
CID 176522224 (PubChem CID 176522224) has the molecular formula C6H17Cl2N5O4 and a molecular weight of 294.14 g/mol.
| Compound Name | CID 176522224 |
|---|---|
| PubChem CID | 176522224 |
| Molecular Formula | C6H17Cl2N5O4 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | — |
| SMILES | Cl.[H]/N=C(\N)N/C(N)=N/CCCC.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H15N5.ClHO4.ClH/c1-2-3-4-10-6(9)11-5(7)8;2-1(3,4)5;/h2-4H2,1H3,(H6,7,8,9,10,11);(H,2,3,4,5);1H |
| InChIKey | POZRMSXAZVQCOT-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 189.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|