C10H19N5O4 — CID 176533786
(E)-but-2-enedioic acid;2-butyl-1-carbamimidoylguanidine (PubChem CID 176533786) has the molecular formula C10H19N5O4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-butyl-1-carbamimidoylguanidine.
| Compound Name | (E)-but-2-enedioic acid;2-butyl-1-carbamimidoylguanidine |
|---|---|
| PubChem CID | 176533786 |
| Molecular Formula | C10H19N5O4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (E)-but-2-enedioic acid;2-butyl-1-carbamimidoylguanidine |
| SMILES | O=C(O)/C=C/C(=O)O.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.C4H4O4/c1-2-3-4-10-6(9)11-5(7)8;5-3(6)1-2-4(7)8/h2-4H2,1H3,(H6,7,8,9,10,11);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KFPZAWGWMCLBOH-WLHGVMLRSA-N |
| XLogP | -0.70 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|