C6H18ClN5O2 — CID 176535329
2-butyl-1-carbamimidoylguanidine;hydrogen peroxide;hydrochloride (PubChem CID 176535329) has the molecular formula C6H18ClN5O2 and a molecular weight of 227.70 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;hydrogen peroxide;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;hydrogen peroxide;hydrochloride |
|---|---|
| PubChem CID | 176535329 |
| Molecular Formula | C6H18ClN5O2 |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;hydrogen peroxide;hydrochloride |
| SMILES | Cl.OO.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.ClH.H2O2/c1-2-3-4-10-6(9)11-5(7)8;;1-2/h2-4H2,1H3,(H6,7,8,9,10,11);1H;1-2H |
| InChIKey | RTVMGLUOWKPSRZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|