C7H17ClN6O — CID 176524968
2-butyl-1-carbamimidoylguanidine;cyanic acid;hydrochloride (PubChem CID 176524968) has the molecular formula C7H17ClN6O and a molecular weight of 236.71 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;cyanic acid;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;cyanic acid;hydrochloride |
|---|---|
| PubChem CID | 176524968 |
| Molecular Formula | C7H17ClN6O |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;cyanic acid;hydrochloride |
| SMILES | Cl.N#CO.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.CHNO.ClH/c1-2-3-4-10-6(9)11-5(7)8;2-1-3;/h2-4H2,1H3,(H6,7,8,9,10,11);3H;1H |
| InChIKey | RWNQIECDZMFAMR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|