C6H17ClN6O3 — CID 176536553
2-butyl-1-carbamimidoylguanidine;nitric acid;hydrochloride (PubChem CID 176536553) has the molecular formula C6H17ClN6O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;nitric acid;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;nitric acid;hydrochloride |
|---|---|
| PubChem CID | 176536553 |
| Molecular Formula | C6H17ClN6O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;nitric acid;hydrochloride |
| SMILES | Cl.O=[N+]([O-])O.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.ClH.HNO3/c1-2-3-4-10-6(9)11-5(7)8;;2-1(3)4/h2-4H2,1H3,(H6,7,8,9,10,11);1H;(H,2,3,4) |
| InChIKey | WZPPWWWGGBGHIF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|