C12H28N10 — CID 176524022
2-[8-[[amino(carbamimidamido)methylidene]amino]octyl]-1-carbamimidoylguanidine (PubChem CID 176524022) has the molecular formula C12H28N10 and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-[8-[[amino(carbamimidamido)methylidene]amino]octyl]-1-carbamimidoylguanidine.
| Compound Name | 2-[8-[[amino(carbamimidamido)methylidene]amino]octyl]-1-carbamimidoylguanidine |
|---|---|
| PubChem CID | 176524022 |
| Molecular Formula | C12H28N10 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-[8-[[amino(carbamimidamido)methylidene]amino]octyl]-1-carbamimidoylguanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CCCCCCCC/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C12H28N10/c13-9(14)21-11(17)19-7-5-3-1-2-4-6-8-20-12(18)22-10(15)16/h1-8H2,(H6,13,14,17,19,21)(H6,15,16,18,20,22) |
| InChIKey | NVCXIHMOEIDCKV-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|