C9H23ClN6 — CID 176540701
1-carbamimidoyl-2-[3-(diethylamino)propyl]guanidine;hydron;chloride (PubChem CID 176540701) has the molecular formula C9H23ClN6 and a molecular weight of 250.78 g/mol. Its IUPAC name is 1-carbamimidoyl-2-[3-(diethylamino)propyl]guanidine;hydron;chloride.
| Compound Name | 1-carbamimidoyl-2-[3-(diethylamino)propyl]guanidine;hydron;chloride |
|---|---|
| PubChem CID | 176540701 |
| Molecular Formula | C9H23ClN6 |
| Molecular Weight | 250.78 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-carbamimidoyl-2-[3-(diethylamino)propyl]guanidine;hydron;chloride |
| SMILES | [Cl-].[H+].[H]/N=C(\N)N/C(N)=N/CCCN(CC)CC |
| InChI | InChI=1S/C9H22N6.ClH/c1-3-15(4-2)7-5-6-13-9(12)14-8(10)11;/h3-7H2,1-2H3,(H6,10,11,12,13,14);1H |
| InChIKey | GBNPLWLDSSLHCE-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.78 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|