C10H24N6 — CID 176547006
1-carbamimidoyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine (PubChem CID 176547006) has the molecular formula C10H24N6 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-carbamimidoyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine.
| Compound Name | 1-carbamimidoyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
|---|---|
| PubChem CID | 176547006 |
| Molecular Formula | C10H24N6 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1-carbamimidoyl-2-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CCCCN(C)C(C)C |
| InChI | InChI=1S/C10H24N6/c1-8(2)16(3)7-5-4-6-14-10(13)15-9(11)12/h8H,4-7H2,1-3H3,(H6,11,12,13,14,15) |
| InChIKey | KRLQVQHLMLBBNG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|