About [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium
[[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium (PubChem CID 6332029) has the molecular formula C8H20N5O2+
and a molecular weight of 218.28 g/mol. Its IUPAC name is [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium.
Molecular Properties
| Compound Name | [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
| PubChem CID | 6332029 |
| Molecular Formula | C8H20N5O2+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
| SMILES | CCN(CC)CCC/N=C(\N)N[N+](=O)O |
| InChI | InChI=1S/C8H20N5O2/c1-3-12(4-2)7-5-6-10-8(9)11-13(14)15/h3-7H2,1-2H3,(H,14,15)(H3,9,10,11)/q+1 |
| InChIKey | DWRAAMMUVULDCX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium?
The IUPAC name of [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium (CID 6332029) is [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium.
What is the SMILES notation for [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium?
The canonical SMILES for [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium is CCN(CC)CCC/N=C(\N)N[N+](=O)O.
What is the InChIKey of [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium?
The InChIKey is DWRAAMMUVULDCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N5O2/c1-3-12(4-2)7-5-6-10-8(9)11-13(14)15/h3-7H2,1-2H3,(H,14,15)(H3,9,10,11)/q+1.
What are the key properties of [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium?
[[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium has a molecular weight of 218.28 g/mol, XLogP of -0.29, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium is sourced from PubChem (CID 6332029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).