C8H20N5O2+ — CID 6332029
[[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium (PubChem CID 6332029) has the molecular formula C8H20N5O2+ and a molecular weight of 218.28 g/mol. Its IUPAC name is [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium.
| Compound Name | [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 6332029 |
| Molecular Formula | C8H20N5O2+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | [[N'-[3-(diethylamino)propyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
| SMILES | CCN(CC)CCC/N=C(\N)N[N+](=O)O |
| InChI | InChI=1S/C8H20N5O2/c1-3-12(4-2)7-5-6-10-8(9)11-13(14)15/h3-7H2,1-2H3,(H,14,15)(H3,9,10,11)/q+1 |
| InChIKey | DWRAAMMUVULDCX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|