C8H22N7O2+ — CID 6334562
[[N'-[4-amino-5-(2-aminoethylamino)pentyl]carbamimidoyl]amino]-hydroxy-oxoazanium (PubChem CID 6334562) has the molecular formula C8H22N7O2+ and a molecular weight of 248.31 g/mol. Its IUPAC name is [[N'-[4-amino-5-(2-aminoethylamino)pentyl]carbamimidoyl]amino]-hydroxy-oxoazanium.
| Compound Name | [[N'-[4-amino-5-(2-aminoethylamino)pentyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 6334562 |
| Molecular Formula | C8H22N7O2+ |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [[N'-[4-amino-5-(2-aminoethylamino)pentyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
| SMILES | NCCNCC(N)CCC/N=C(\N)N[N+](=O)O |
| InChI | InChI=1S/C8H22N7O2/c9-3-5-12-6-7(10)2-1-4-13-8(11)14-15(16)17/h7,12H,1-6,9-10H2,(H,16,17)(H3,11,13,14)/q+1 |
| InChIKey | HZXZKGVMNSDTOG-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 154.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|