C8H21N7 — CID 150669227
2-(3-aminopropyl)-1-[N'-(3-aminopropyl)carbamimidoyl]guanidine (PubChem CID 150669227) has the molecular formula C8H21N7 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1-[N'-(3-aminopropyl)carbamimidoyl]guanidine.
| Compound Name | 2-(3-aminopropyl)-1-[N'-(3-aminopropyl)carbamimidoyl]guanidine |
|---|---|
| PubChem CID | 150669227 |
| Molecular Formula | C8H21N7 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-(3-aminopropyl)-1-[N'-(3-aminopropyl)carbamimidoyl]guanidine |
| SMILES | NCCC/N=C(\N)N/C(N)=N/CCCN |
| InChI | InChI=1S/C8H21N7/c9-3-1-5-13-7(11)15-8(12)14-6-2-4-10/h1-6,9-10H2,(H5,11,12,13,14,15) |
| InChIKey | JFNKLDKEVVQPLC-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|