C18H36N8 — CID 158684946
1-[N'-(6-aminohexyl)carbamimidoyl]-2-(9-cyano-8-iminononyl)guanidine (PubChem CID 158684946) has the molecular formula C18H36N8 and a molecular weight of 364.54 g/mol. Its IUPAC name is 1-[N'-(6-aminohexyl)carbamimidoyl]-2-(9-cyano-8-iminononyl)guanidine.
| Compound Name | 1-[N'-(6-aminohexyl)carbamimidoyl]-2-(9-cyano-8-iminononyl)guanidine |
|---|---|
| PubChem CID | 158684946 |
| Molecular Formula | C18H36N8 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1-[N'-(6-aminohexyl)carbamimidoyl]-2-(9-cyano-8-iminononyl)guanidine |
| SMILES | [H]/N=C(\CC#N)CCCCCCC/N=C(\N)N/C(N)=N/CCCCCCN |
| InChI | InChI=1S/C18H36N8/c19-12-7-3-5-9-15-25-18(23)26-17(22)24-14-8-4-1-2-6-10-16(21)11-13-20/h21H,1-12,14-15,19H2,(H5,22,23,24,25,26)/b21-16- |
| InChIKey | NHQLZLVTFCDFNA-PGMHBOJBSA-N |
| XLogP | 2.00 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|