C9H19N7 — CID 176546132
2-(6-carbamimidamidohexyl)-1-cyanoguanidine (PubChem CID 176546132) has the molecular formula C9H19N7 and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-(6-carbamimidamidohexyl)-1-cyanoguanidine.
| Compound Name | 2-(6-carbamimidamidohexyl)-1-cyanoguanidine |
|---|---|
| PubChem CID | 176546132 |
| Molecular Formula | C9H19N7 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-(6-carbamimidamidohexyl)-1-cyanoguanidine |
| SMILES | [H]/N=C(\N)NCCCCCC/N=C(\N)NC#N |
| InChI | InChI=1S/C9H19N7/c10-7-16-9(13)15-6-4-2-1-3-5-14-8(11)12/h1-6H2,(H4,11,12,14)(H3,13,15,16) |
| InChIKey | KSLBLLKOIMHZRV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|