C14H25ClN6 — CID 176532079
chlorobenzene;1-[6-(diaminomethylideneamino)hexyl]guanidine (PubChem CID 176532079) has the molecular formula C14H25ClN6 and a molecular weight of 312.85 g/mol. Its IUPAC name is chlorobenzene;1-[6-(diaminomethylideneamino)hexyl]guanidine.
| Compound Name | chlorobenzene;1-[6-(diaminomethylideneamino)hexyl]guanidine |
|---|---|
| PubChem CID | 176532079 |
| Molecular Formula | C14H25ClN6 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | chlorobenzene;1-[6-(diaminomethylideneamino)hexyl]guanidine |
| SMILES | Clc1ccccc1.[H]/N=C(\N)NCCCCCCN=C(N)N |
| InChI | InChI=1S/C8H20N6.C6H5Cl/c9-7(10)13-5-3-1-2-4-6-14-8(11)12;7-6-4-2-1-3-5-6/h1-6H2,(H4,9,10,13)(H4,11,12,14);1-5H |
| InChIKey | FASRGTUWYULFIJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|