C12H30Cl2N6 — CID 176533607
1-[10-(diaminomethylideneamino)decyl]guanidine;hydron;dichloride (PubChem CID 176533607) has the molecular formula C12H30Cl2N6 and a molecular weight of 329.32 g/mol. Its IUPAC name is 1-[10-(diaminomethylideneamino)decyl]guanidine;hydron;dichloride.
| Compound Name | 1-[10-(diaminomethylideneamino)decyl]guanidine;hydron;dichloride |
|---|---|
| PubChem CID | 176533607 |
| Molecular Formula | C12H30Cl2N6 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[10-(diaminomethylideneamino)decyl]guanidine;hydron;dichloride |
| SMILES | [Cl-].[Cl-].[H+].[H+].[H]/N=C(\N)NCCCCCCCCCCN=C(N)N |
| InChI | InChI=1S/C12H28N6.2ClH/c13-11(14)17-9-7-5-3-1-2-4-6-8-10-18-12(15)16;;/h1-10H2,(H4,13,14,17)(H4,15,16,18);2*1H |
| InChIKey | HJJOBGICUREWHC-UHFFFAOYSA-N |
| XLogP | -4.90 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|