C9H28N18 — CID 176518855
1,3-bis(diaminomethylidene)guanidine;1-carbamimidoylguanidine;1-[2-(diaminomethylideneamino)ethyl]guanidine (PubChem CID 176518855) has the molecular formula C9H28N18 and a molecular weight of 388.45 g/mol. Its IUPAC name is 1,3-bis(diaminomethylidene)guanidine;1-carbamimidoylguanidine;1-[2-(diaminomethylideneamino)ethyl]guanidine.
| Compound Name | 1,3-bis(diaminomethylidene)guanidine;1-carbamimidoylguanidine;1-[2-(diaminomethylideneamino)ethyl]guanidine |
|---|---|
| PubChem CID | 176518855 |
| Molecular Formula | C9H28N18 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 1,3-bis(diaminomethylidene)guanidine;1-carbamimidoylguanidine;1-[2-(diaminomethylideneamino)ethyl]guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/[H].[H]/N=C(\N)NCCN=C(N)N.[H]N=C(N=C(N)N)N=C(N)N |
| InChI | InChI=1S/C4H12N6.C3H9N7.C2H7N5/c5-3(6)9-1-2-10-4(7)8;4-1(5)9-3(8)10-2(6)7;3-1(4)7-2(5)6/h1-2H2,(H4,5,6,9)(H4,7,8,10);(H9,4,5,6,7,8,9,10);(H7,3,4,5,6,7) |
| InChIKey | DSZNUXQDIKCJCA-UHFFFAOYSA-N |
| XLogP | -6.43 |
| TPSA | 390.72 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | -6.43 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|