About 1-carbamimidoylguanidine;oxovanadium(2+)
1-carbamimidoylguanidine;oxovanadium(2+) (PubChem CID 176523770) has the molecular formula C2H7N5OV+2
and a molecular weight of 168.06 g/mol. Its IUPAC name is 1-carbamimidoylguanidine;oxovanadium(2+).
Molecular Properties
| Compound Name | 1-carbamimidoylguanidine;oxovanadium(2+) |
| PubChem CID | 176523770 |
| Molecular Formula | C2H7N5OV+2 |
| Molecular Weight | 168.06 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 1-carbamimidoylguanidine;oxovanadium(2+) |
| SMILES | O=[V+2].[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C2H7N5.O.V/c3-1(4)7-2(5)6;;/h(H7,3,4,5,6,7);;/q;;+2 |
| InChIKey | VMHNZCCGPPEEOD-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.06 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoylguanidine;oxovanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoylguanidine;oxovanadium(2+)?
The IUPAC name of 1-carbamimidoylguanidine;oxovanadium(2+) (CID 176523770) is 1-carbamimidoylguanidine;oxovanadium(2+).
What is the SMILES notation for 1-carbamimidoylguanidine;oxovanadium(2+)?
The canonical SMILES for 1-carbamimidoylguanidine;oxovanadium(2+) is O=[V+2].[H]/N=C(\N)N/C(N)=N/[H].
What is the InChIKey of 1-carbamimidoylguanidine;oxovanadium(2+)?
The InChIKey is VMHNZCCGPPEEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N5.O.V/c3-1(4)7-2(5)6;;/h(H7,3,4,5,6,7);;/q;;+2.
What are the key properties of 1-carbamimidoylguanidine;oxovanadium(2+)?
1-carbamimidoylguanidine;oxovanadium(2+) has a molecular weight of 168.06 g/mol, XLogP of -1.76, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoylguanidine;oxovanadium(2+) is sourced from PubChem (CID 176523770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).