About 1-carbamimidoylguanidine;ethane;dihydrate
1-carbamimidoylguanidine;ethane;dihydrate (PubChem CID 176527155) has the molecular formula C4H17N5O2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-carbamimidoylguanidine;ethane;dihydrate.
Molecular Properties
| Compound Name | 1-carbamimidoylguanidine;ethane;dihydrate |
| PubChem CID | 176527155 |
| Molecular Formula | C4H17N5O2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-carbamimidoylguanidine;ethane;dihydrate |
| SMILES | CC.O.O.[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C2H7N5.C2H6.2H2O/c3-1(4)7-2(5)6;1-2;;/h(H7,3,4,5,6,7);1-2H3;2*1H2 |
| InChIKey | OWKRHZKLKVEFMW-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 174.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoylguanidine;ethane;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoylguanidine;ethane;dihydrate?
The IUPAC name of 1-carbamimidoylguanidine;ethane;dihydrate (CID 176527155) is 1-carbamimidoylguanidine;ethane;dihydrate.
What is the SMILES notation for 1-carbamimidoylguanidine;ethane;dihydrate?
The canonical SMILES for 1-carbamimidoylguanidine;ethane;dihydrate is CC.O.O.[H]/N=C(\N)N/C(N)=N/[H].
What is the InChIKey of 1-carbamimidoylguanidine;ethane;dihydrate?
The InChIKey is OWKRHZKLKVEFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N5.C2H6.2H2O/c3-1(4)7-2(5)6;1-2;;/h(H7,3,4,5,6,7);1-2H3;2*1H2.
What are the key properties of 1-carbamimidoylguanidine;ethane;dihydrate?
1-carbamimidoylguanidine;ethane;dihydrate has a molecular weight of 167.21 g/mol, XLogP of -2.26, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoylguanidine;ethane;dihydrate is sourced from PubChem (CID 176527155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).