C7H18N10 — CID 176524679
2-[1-[[amino(carbamimidamido)methylidene]amino]propyl]-1-carbamimidoylguanidine (PubChem CID 176524679) has the molecular formula C7H18N10 and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-[1-[[amino(carbamimidamido)methylidene]amino]propyl]-1-carbamimidoylguanidine.
| Compound Name | 2-[1-[[amino(carbamimidamido)methylidene]amino]propyl]-1-carbamimidoylguanidine |
|---|---|
| PubChem CID | 176524679 |
| Molecular Formula | C7H18N10 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-[1-[[amino(carbamimidamido)methylidene]amino]propyl]-1-carbamimidoylguanidine |
| SMILES | [H]/N=C(\N)NC(N)=NC(CC)N=C(N)N/C(N)=N/[H] |
| InChI | InChI=1S/C7H18N10/c1-2-3(14-6(12)16-4(8)9)15-7(13)17-5(10)11/h3H,2H2,1H3,(H6,8,9,12,14,16)(H6,10,11,13,15,17) |
| InChIKey | XXIXSHKMUXNYPT-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|