C6H15N5O — CID 176530165
1-carbamimidoyl-2-(2-ethoxyethyl)guanidine (PubChem CID 176530165) has the molecular formula C6H15N5O and a molecular weight of 173.22 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(2-ethoxyethyl)guanidine.
| Compound Name | 1-carbamimidoyl-2-(2-ethoxyethyl)guanidine |
|---|---|
| PubChem CID | 176530165 |
| Molecular Formula | C6H15N5O |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | 1-carbamimidoyl-2-(2-ethoxyethyl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CCOCC |
| InChI | InChI=1S/C6H15N5O/c1-2-12-4-3-10-6(9)11-5(7)8/h2-4H2,1H3,(H6,7,8,9,10,11) |
| InChIKey | WEXVAVLHDUEXOD-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|