C8H19Cl2N5O — CID 176521105
acetyl chloride;2-butyl-1-carbamimidoylguanidine;hydrochloride (PubChem CID 176521105) has the molecular formula C8H19Cl2N5O and a molecular weight of 272.18 g/mol. Its IUPAC name is acetyl chloride;2-butyl-1-carbamimidoylguanidine;hydrochloride.
| Compound Name | acetyl chloride;2-butyl-1-carbamimidoylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176521105 |
| Molecular Formula | C8H19Cl2N5O |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | acetyl chloride;2-butyl-1-carbamimidoylguanidine;hydrochloride |
| SMILES | CC(=O)Cl.Cl.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.C2H3ClO.ClH/c1-2-3-4-10-6(9)11-5(7)8;1-2(3)4;/h2-4H2,1H3,(H6,7,8,9,10,11);1H3;1H |
| InChIKey | QPHZXISMFJZNCB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|