C12H24ClN7 — CID 176543735
benzene-1,3-diamine;2-butyl-1-carbamimidoylguanidine;hydrochloride (PubChem CID 176543735) has the molecular formula C12H24ClN7 and a molecular weight of 301.83 g/mol. Its IUPAC name is benzene-1,3-diamine;2-butyl-1-carbamimidoylguanidine;hydrochloride.
| Compound Name | benzene-1,3-diamine;2-butyl-1-carbamimidoylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176543735 |
| Molecular Formula | C12H24ClN7 |
| Molecular Weight | 301.83 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | benzene-1,3-diamine;2-butyl-1-carbamimidoylguanidine;hydrochloride |
| SMILES | Cl.Nc1cccc(N)c1.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.C6H8N2.ClH/c1-2-3-4-10-6(9)11-5(7)8;7-5-2-1-3-6(8)4-5;/h2-4H2,1H3,(H6,7,8,9,10,11);1-4H,7-8H2;1H |
| InChIKey | PDULKNSSRXGZQY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 152.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.83 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|