C19H28N8 — CID 176533869
2-butyl-1-carbamimidoylguanidine;1,2-diphenylguanidine (PubChem CID 176533869) has the molecular formula C19H28N8 and a molecular weight of 368.49 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;1,2-diphenylguanidine.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;1,2-diphenylguanidine |
|---|---|
| PubChem CID | 176533869 |
| Molecular Formula | C19H28N8 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;1,2-diphenylguanidine |
| SMILES | N/C(=N\c1ccccc1)Nc1ccccc1.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C13H13N3.C6H15N5/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-2-3-4-10-6(9)11-5(7)8/h1-10H,(H3,14,15,16);2-4H2,1H3,(H6,7,8,9,10,11) |
| InChIKey | CSZJPHXMVZBSNR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 150.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|