C23H38Cl2N6O — CID 176527084
2-benzhydryloxy-N,N-dimethylethanamine;2-butyl-1-carbamimidoylguanidine;dihydrochloride (PubChem CID 176527084) has the molecular formula C23H38Cl2N6O and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-benzhydryloxy-N,N-dimethylethanamine;2-butyl-1-carbamimidoylguanidine;dihydrochloride.
| Compound Name | 2-benzhydryloxy-N,N-dimethylethanamine;2-butyl-1-carbamimidoylguanidine;dihydrochloride |
|---|---|
| PubChem CID | 176527084 |
| Molecular Formula | C23H38Cl2N6O |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;2-butyl-1-carbamimidoylguanidine;dihydrochloride |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccccc1.Cl.Cl.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C17H21NO.C6H15N5.2ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-2-3-4-10-6(9)11-5(7)8;;/h3-12,17H,13-14H2,1-2H3;2-4H2,1H3,(H6,7,8,9,10,11);2*1H |
| InChIKey | FFUJGAAWMLWMLX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|