C12H28ClN5O2 — CID 176532485
2-butyl-1-carbamimidoylguanidine;oxetane;hydrochloride (PubChem CID 176532485) has the molecular formula C12H28ClN5O2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;oxetane;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;oxetane;hydrochloride |
|---|---|
| PubChem CID | 176532485 |
| Molecular Formula | C12H28ClN5O2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;oxetane;hydrochloride |
| SMILES | C1COC1.C1COC1.Cl.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.2C3H6O.ClH/c1-2-3-4-10-6(9)11-5(7)8;2*1-2-4-3-1;/h2-4H2,1H3,(H6,7,8,9,10,11);2*1-3H2;1H |
| InChIKey | KOHRFIPZYZSEEL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|