C14H34ClN7 — CID 176537270
[1-(aminomethyl)cyclohexyl]methanamine;2-butyl-1-carbamimidoylguanidine;hydrochloride (PubChem CID 176537270) has the molecular formula C14H34ClN7 and a molecular weight of 335.93 g/mol. Its IUPAC name is [1-(aminomethyl)cyclohexyl]methanamine;2-butyl-1-carbamimidoylguanidine;hydrochloride.
| Compound Name | [1-(aminomethyl)cyclohexyl]methanamine;2-butyl-1-carbamimidoylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176537270 |
| Molecular Formula | C14H34ClN7 |
| Molecular Weight | 335.93 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | [1-(aminomethyl)cyclohexyl]methanamine;2-butyl-1-carbamimidoylguanidine;hydrochloride |
| SMILES | Cl.NCC1(CN)CCCCC1.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C8H18N2.C6H15N5.ClH/c9-6-8(7-10)4-2-1-3-5-8;1-2-3-4-10-6(9)11-5(7)8;/h1-7,9-10H2;2-4H2,1H3,(H6,7,8,9,10,11);1H |
| InChIKey | KIBZDUQVXFFFTF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 152.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.93 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|