C12H25N5 — CID 176546953
1-carbamimidoyl-2-[[1-(2-methylpropyl)cyclopentyl]methyl]guanidine (PubChem CID 176546953) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is 1-carbamimidoyl-2-[[1-(2-methylpropyl)cyclopentyl]methyl]guanidine.
| Compound Name | 1-carbamimidoyl-2-[[1-(2-methylpropyl)cyclopentyl]methyl]guanidine |
|---|---|
| PubChem CID | 176546953 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | 1-carbamimidoyl-2-[[1-(2-methylpropyl)cyclopentyl]methyl]guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CC1(CC(C)C)CCCC1 |
| InChI | InChI=1S/C12H25N5/c1-9(2)7-12(5-3-4-6-12)8-16-11(15)17-10(13)14/h9H,3-8H2,1-2H3,(H6,13,14,15,16,17) |
| InChIKey | HNVSRBYXZYNXTH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|