C14H26ClN5O — CID 176531380
2-butyl-1-carbamimidoylguanidine;2-phenylethanol;hydrochloride (PubChem CID 176531380) has the molecular formula C14H26ClN5O and a molecular weight of 315.85 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;2-phenylethanol;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;2-phenylethanol;hydrochloride |
|---|---|
| PubChem CID | 176531380 |
| Molecular Formula | C14H26ClN5O |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;2-phenylethanol;hydrochloride |
| SMILES | Cl.OCCc1ccccc1.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C8H10O.C6H15N5.ClH/c9-7-6-8-4-2-1-3-5-8;1-2-3-4-10-6(9)11-5(7)8;/h1-5,9H,6-7H2;2-4H2,1H3,(H6,7,8,9,10,11);1H |
| InChIKey | GKXDIQTVGQIGMA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|