C19H33N3 — CID 101076594
2-dodecyl-1-phenylguanidine (PubChem CID 101076594) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is 2-dodecyl-1-phenylguanidine.
| Compound Name | 2-dodecyl-1-phenylguanidine |
|---|---|
| PubChem CID | 101076594 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | 2-dodecyl-1-phenylguanidine |
| SMILES | CCCCCCCCCCCC/N=C(\N)Nc1ccccc1 |
| InChI | InChI=1S/C19H33N3/c1-2-3-4-5-6-7-8-9-10-14-17-21-19(20)22-18-15-12-11-13-16-18/h11-13,15-16H,2-10,14,17H2,1H3,(H3,20,21,22) |
| InChIKey | ZJFPHIFJVICLJD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|