C11H18IN3O2S — CID 110912521
2-(3-methylsulfonylpropyl)-1-phenylguanidine;hydroiodide (PubChem CID 110912521) has the molecular formula C11H18IN3O2S and a molecular weight of 383.26 g/mol. Its IUPAC name is 2-(3-methylsulfonylpropyl)-1-phenylguanidine;hydroiodide.
| Compound Name | 2-(3-methylsulfonylpropyl)-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110912521 |
| Molecular Formula | C11H18IN3O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-(3-methylsulfonylpropyl)-1-phenylguanidine;hydroiodide |
| SMILES | CS(=O)(=O)CCC/N=C(\N)Nc1ccccc1.I |
| InChI | InChI=1S/C11H17N3O2S.HI/c1-17(15,16)9-5-8-13-11(12)14-10-6-3-2-4-7-10;/h2-4,6-7H,5,8-9H2,1H3,(H3,12,13,14);1H |
| InChIKey | YIESVXWJDZTCOU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|