C9H15IN4O2S — CID 110912467
1-phenyl-2-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 110912467) has the molecular formula C9H15IN4O2S and a molecular weight of 370.22 g/mol. Its IUPAC name is 1-phenyl-2-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-phenyl-2-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110912467 |
| Molecular Formula | C9H15IN4O2S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 1-phenyl-2-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCS(N)(=O)=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H14N4O2S.HI/c10-9(12-6-7-16(11,14)15)13-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H3,10,12,13)(H2,11,14,15);1H |
| InChIKey | QVIQLKRCOUXMSZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|