C11H19IN4O2S — CID 111046592
1-(3,4-dimethylphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111046592) has the molecular formula C11H19IN4O2S and a molecular weight of 398.27 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046592 |
| Molecular Formula | C11H19IN4O2S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCS(N)(=O)=O)cc1C.I |
| InChI | InChI=1S/C11H18N4O2S.HI/c1-8-3-4-10(7-9(8)2)15-11(12)14-5-6-18(13,16)17;/h3-4,7H,5-6H2,1-2H3,(H3,12,14,15)(H2,13,16,17);1H |
| InChIKey | LPFQYFVZKZYFQF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|