C15H24IN3O2 — CID 111025604
ethyl 4-[[amino-(3,4-dimethylanilino)methylidene]amino]butanoate;hydroiodide (PubChem CID 111025604) has the molecular formula C15H24IN3O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is ethyl 4-[[amino-(3,4-dimethylanilino)methylidene]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[amino-(3,4-dimethylanilino)methylidene]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111025604 |
| Molecular Formula | C15H24IN3O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | ethyl 4-[[amino-(3,4-dimethylanilino)methylidene]amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCC/N=C(\N)Nc1ccc(C)c(C)c1.I |
| InChI | InChI=1S/C15H23N3O2.HI/c1-4-20-14(19)6-5-9-17-15(16)18-13-8-7-11(2)12(3)10-13;/h7-8,10H,4-6,9H2,1-3H3,(H3,16,17,18);1H |
| InChIKey | HDSFAMLGRRCPKZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|