C16H25N3O4 — CID 110062014
propan-2-yl 4-[[amino-(3,4-dimethoxyanilino)methylidene]amino]butanoate (PubChem CID 110062014) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is propan-2-yl 4-[[amino-(3,4-dimethoxyanilino)methylidene]amino]butanoate.
| Compound Name | propan-2-yl 4-[[amino-(3,4-dimethoxyanilino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 110062014 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | propan-2-yl 4-[[amino-(3,4-dimethoxyanilino)methylidene]amino]butanoate |
| SMILES | COc1ccc(N/C(N)=N/CCCC(=O)OC(C)C)cc1OC |
| InChI | InChI=1S/C16H25N3O4/c1-11(2)23-15(20)6-5-9-18-16(17)19-12-7-8-13(21-3)14(10-12)22-4/h7-8,10-11H,5-6,9H2,1-4H3,(H3,17,18,19) |
| InChIKey | NMDMBBXIBQYPDZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|