C18H32N4O2 — CID 111077445
1-(3,4-dimethoxyphenyl)-2-[3-(dipropylamino)propyl]guanidine (PubChem CID 111077445) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[3-(dipropylamino)propyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[3-(dipropylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111077445 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[3-(dipropylamino)propyl]guanidine |
| SMILES | CCCN(CCC)CCC/N=C(\N)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H32N4O2/c1-5-11-22(12-6-2)13-7-10-20-18(19)21-15-8-9-16(23-3)17(14-15)24-4/h8-9,14H,5-7,10-13H2,1-4H3,(H3,19,20,21) |
| InChIKey | BBFJKODRLZIAGS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|