C15H24F3IN4O2 — CID 111066486
1-(3,4-dimethoxyphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111066486) has the molecular formula C15H24F3IN4O2 and a molecular weight of 476.28 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066486 |
| Molecular Formula | C15H24F3IN4O2 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCCN(C)CC(F)(F)F)cc1OC.I |
| InChI | InChI=1S/C15H23F3N4O2.HI/c1-22(10-15(16,17)18)8-4-7-20-14(19)21-11-5-6-12(23-2)13(9-11)24-3;/h5-6,9H,4,7-8,10H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | ILUDTUJSHDXDMF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|