C14H22F3IN4 — CID 111066442
1-(3-methylphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111066442) has the molecular formula C14H22F3IN4 and a molecular weight of 430.26 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methylphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066442 |
| Molecular Formula | C14H22F3IN4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 1-(3-methylphenyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CCCN(C)CC(F)(F)F)c1.I |
| InChI | InChI=1S/C14H21F3N4.HI/c1-11-5-3-6-12(9-11)20-13(18)19-7-4-8-21(2)10-14(15,16)17;/h3,5-6,9H,4,7-8,10H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | YLNLIRCVPSRHKI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|