C13H21IN4O — CID 111068179
3-[[amino-(3-methylanilino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111068179) has the molecular formula C13H21IN4O and a molecular weight of 376.24 g/mol. Its IUPAC name is 3-[[amino-(3-methylanilino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-(3-methylanilino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111068179 |
| Molecular Formula | C13H21IN4O |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-[[amino-(3-methylanilino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CCC(=O)N(C)C)c1.I |
| InChI | InChI=1S/C13H20N4O.HI/c1-10-5-4-6-11(9-10)16-13(14)15-8-7-12(18)17(2)3;/h4-6,9H,7-8H2,1-3H3,(H3,14,15,16);1H |
| InChIKey | NFFPCFOPMVJUGE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|